C16H14ClNO2 — CID 823401
2-(2-chlorophenoxy)-1-(2,3-dihydroindol-1-yl)ethanone (PubChem CID 823401) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-1-(2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(2-chlorophenoxy)-1-(2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 823401 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-(2-chlorophenoxy)-1-(2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(COc1ccccc1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H14ClNO2/c17-13-6-2-4-8-15(13)20-11-16(19)18-10-9-12-5-1-3-7-14(12)18/h1-8H,9-11H2 |
| InChIKey | FARCQLXGPPXJPT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |