C16H14FNO2 — CID 828891
1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenoxy)ethanone (PubChem CID 828891) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenoxy)ethanone.
| Compound Name | 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 828891 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(2,3-dihydroindol-1-yl)-2-(4-fluorophenoxy)ethanone |
| SMILES | O=C(COc1ccc(F)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H14FNO2/c17-13-5-7-14(8-6-13)20-11-16(19)18-10-9-12-3-1-2-4-15(12)18/h1-8H,9-11H2 |
| InChIKey | PGSDZQFBMHNPFI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |