C22H26FN3O2 — CID 22390830
2,3-dihydroindol-1-yl-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]methanone (PubChem CID 22390830) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22390830 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[4-[3-(4-fluorophenoxy)propyl]piperazin-1-yl]methanone |
| SMILES | O=C(N1CCN(CCCOc2ccc(F)cc2)CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H26FN3O2/c23-19-6-8-20(9-7-19)28-17-3-11-24-13-15-25(16-14-24)22(27)26-12-10-18-4-1-2-5-21(18)26/h1-2,4-9H,3,10-17H2 |
| InChIKey | GIOUOTIBLZSUAV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|