C16H16FNO — CID 82089229
1-[2-(4-fluorophenoxy)ethyl]-2,3-dihydroindole (PubChem CID 82089229) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-2,3-dihydroindole.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 82089229 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-2,3-dihydroindole |
| SMILES | Fc1ccc(OCCN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H16FNO/c17-14-5-7-15(8-6-14)19-12-11-18-10-9-13-3-1-2-4-16(13)18/h1-8H,9-12H2 |
| InChIKey | YVFVZCFQRHRENH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |