C21H25FN2O2 — CID 94016366
(2S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-fluorophenoxy)butanamide (PubChem CID 94016366) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is (2S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 94016366 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (2S)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C21H25FN2O2/c1-2-20(26-18-10-8-17(22)9-11-18)21(25)23-13-5-14-24-15-12-16-6-3-4-7-19(16)24/h3-4,6-11,20H,2,5,12-15H2,1H3,(H,23,25)/t20-/m0/s1 |
| InChIKey | KHZKTCTWAOCLID-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|