C23H30N2O2 — CID 30387653
(2R)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(2-propan-2-ylphenoxy)propanamide (PubChem CID 30387653) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is (2R)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(2-propan-2-ylphenoxy)propanamide.
| Compound Name | (2R)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 30387653 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (2R)-N-[3-(2,3-dihydroindol-1-yl)propyl]-2-(2-propan-2-ylphenoxy)propanamide |
| SMILES | CC(C)c1ccccc1O[C@H](C)C(=O)NCCCN1CCc2ccccc21 |
| InChI | InChI=1S/C23H30N2O2/c1-17(2)20-10-5-7-12-22(20)27-18(3)23(26)24-14-8-15-25-16-13-19-9-4-6-11-21(19)25/h4-7,9-12,17-18H,8,13-16H2,1-3H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | UGUGLKJRSWBUKV-GOSISDBHSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|