C17H16BrNO2 — CID 730148
2-(4-bromophenoxy)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 730148) has the molecular formula C17H16BrNO2 and a molecular weight of 346.22 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-(4-bromophenoxy)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 730148 |
| Molecular Formula | C17H16BrNO2 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-(4-bromophenoxy)-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(Br)cc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H16BrNO2/c18-14-7-9-15(10-8-14)21-12-17(20)19-11-3-5-13-4-1-2-6-16(13)19/h1-2,4,6-10H,3,5,11-12H2 |
| InChIKey | UAVQRADFOYBUSN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |