C18H19NO3 — CID 110749866
1-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-phenoxyethanone (PubChem CID 110749866) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-phenoxyethanone.
| Compound Name | 1-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 110749866 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(7-methoxy-3,4-dihydro-2H-quinolin-1-yl)-2-phenoxyethanone |
| SMILES | COc1ccc2c(c1)N(C(=O)COc1ccccc1)CCC2 |
| InChI | InChI=1S/C18H19NO3/c1-21-16-10-9-14-6-5-11-19(17(14)12-16)18(20)13-22-15-7-3-2-4-8-15/h2-4,7-10,12H,5-6,11,13H2,1H3 |
| InChIKey | UMXNJJVJGPLEDN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |