C17H13ClFNO3 — CID 8619950
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 5-chloro-2-fluorobenzoate (PubChem CID 8619950) has the molecular formula C17H13ClFNO3 and a molecular weight of 333.75 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 5-chloro-2-fluorobenzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
|---|---|
| PubChem CID | 8619950 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 5-chloro-2-fluorobenzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C17H13ClFNO3/c18-12-5-6-14(19)13(9-12)17(22)23-10-16(21)20-8-7-11-3-1-2-4-15(11)20/h1-6,9H,7-8,10H2 |
| InChIKey | TUDDYVFUOWMJSQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |