C17H13ClN2O5 — CID 2433629
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate (PubChem CID 2433629) has the molecular formula C17H13ClN2O5 and a molecular weight of 360.75 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 2433629 |
| Molecular Formula | C17H13ClN2O5 |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-chloro-4-nitrobenzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H13ClN2O5/c18-14-9-12(20(23)24)5-6-13(14)17(22)25-10-16(21)19-8-7-11-3-1-2-4-15(11)19/h1-6,9H,7-8,10H2 |
| InChIKey | UAMLNRBXDNBWSP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|