C23H19N3O8S — CID 4178843
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 4178843) has the molecular formula C23H19N3O8S and a molecular weight of 497.49 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4178843 |
| Molecular Formula | C23H19N3O8S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 2-hydroxy-5-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1cc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C23H19N3O8S/c27-21-9-8-16(24-35(32,33)18-6-3-5-17(13-18)26(30)31)12-19(21)23(29)34-14-22(28)25-11-10-15-4-1-2-7-20(15)25/h1-9,12-13,24,27H,10-11,14H2 |
| InChIKey | QVKPQVBXPYYCBX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|