C22H25N3O8S — CID 25044127
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate (PubChem CID 25044127) has the molecular formula C22H25N3O8S and a molecular weight of 491.52 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25044127 |
| Molecular Formula | C22H25N3O8S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)c1cc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)ccc1O |
| InChI | InChI=1S/C22H25N3O8S/c1-2-16-5-3-4-12-24(16)21(27)14-33-22(28)19-13-18(10-11-20(19)26)34(31,32)23-15-6-8-17(9-7-15)25(29)30/h6-11,13,16,23,26H,2-5,12,14H2,1H3 |
| InChIKey | MBAYXTLUILZXJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|