C25H24N4O9S — CID 25038875
[2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate (PubChem CID 25038875) has the molecular formula C25H24N4O9S and a molecular weight of 556.55 g/mol. Its IUPAC name is [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25038875 |
| Molecular Formula | C25H24N4O9S |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | [2-(4-morpholin-4-ylanilino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)ccc1O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H24N4O9S/c30-23-10-9-21(39(35,36)27-18-3-7-20(8-4-18)29(33)34)15-22(23)25(32)38-16-24(31)26-17-1-5-19(6-2-17)28-11-13-37-14-12-28/h1-10,15,27,30H,11-14,16H2,(H,26,31) |
| InChIKey | ZOQZAEOXIBCTLA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 177.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|