C23H19N3O10S — CID 25043847
[2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate (PubChem CID 25043847) has the molecular formula C23H19N3O10S and a molecular weight of 529.48 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25043847 |
| Molecular Formula | C23H19N3O10S |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-2-oxoethyl] 2-hydroxy-5-[(4-nitrophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)ccc1O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H19N3O10S/c27-19-7-6-17(37(32,33)25-14-1-4-16(5-2-14)26(30)31)12-18(19)23(29)36-13-22(28)24-15-3-8-20-21(11-15)35-10-9-34-20/h1-8,11-12,25,27H,9-10,13H2,(H,24,28) |
| InChIKey | WOMPCSFKYXURLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|