C18H16N2O7 — CID 7463573
[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-nitrobenzoate (PubChem CID 7463573) has the molecular formula C18H16N2O7 and a molecular weight of 372.33 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-nitrobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 7463573 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl] 2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1[N+](=O)[O-])Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H16N2O7/c21-17(11-27-18(22)13-4-1-2-5-14(13)20(23)24)19-12-6-7-15-16(10-12)26-9-3-8-25-15/h1-2,4-7,10H,3,8-9,11H2,(H,19,21) |
| InChIKey | JXTJIZGNMOBQIH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|