About [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate (PubChem CID 9454763) has the molecular formula C21H16N4O5
and a molecular weight of 404.38 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate |
| PubChem CID | 9454763 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1[N+](=O)[O-])Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C21H16N4O5/c26-20(14-30-21(27)18-8-4-5-9-19(18)25(28)29)22-15-10-12-17(13-11-15)24-23-16-6-2-1-3-7-16/h1-13H,14H2,(H,22,26)/b24-23+ |
| InChIKey | HJIMDZXEKSUADQ-WCWDXBQESA-N |
| XLogP | 4.81 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate?
The IUPAC name of [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate (CID 9454763) is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate.
What is the SMILES notation for [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate?
The canonical SMILES for [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate is O=C(COC(=O)c1ccccc1[N+](=O)[O-])Nc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate?
The InChIKey is HJIMDZXEKSUADQ-WCWDXBQESA-N. The full InChI is InChI=1S/C21H16N4O5/c26-20(14-30-21(27)18-8-4-5-9-19(18)25(28)29)22-15-10-12-17(13-11-15)24-23-16-6-2-1-3-7-16/h1-13H,14H2,(H,22,26)/b24-23+.
What are the key properties of [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate?
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate has a molecular weight of 404.38 g/mol, XLogP of 4.81, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-nitrobenzoate is sourced from PubChem (CID 9454763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).