C22H20N4O5S — CID 42985631
[2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 42985631) has the molecular formula C22H20N4O5S and a molecular weight of 452.49 g/mol. Its IUPAC name is [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42985631 |
| Molecular Formula | C22H20N4O5S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [2-oxo-2-(4-phenyldiazenylanilino)ethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)Nc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O5S/c1-15-7-12-19(32(23,29)30)13-20(15)22(28)31-14-21(27)24-16-8-10-18(11-9-16)26-25-17-5-3-2-4-6-17/h2-13H,14H2,1H3,(H,24,27)(H2,23,29,30)/b26-25+ |
| InChIKey | OMFZWUFTMQAQHR-OCEACIFDSA-N |
| XLogP | 3.85 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|