C20H22N2O5S — CID 55525907
[2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 55525907) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55525907 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | [2-oxo-2-[(1-phenylcyclopropyl)methylamino]ethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)NCC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22N2O5S/c1-14-7-8-16(28(21,25)26)11-17(14)19(24)27-12-18(23)22-13-20(9-10-20)15-5-3-2-4-6-15/h2-8,11H,9-10,12-13H2,1H3,(H,22,23)(H2,21,25,26) |
| InChIKey | NTMJIZXVMVHZGW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |