C17H22N2O6S — CID 55320891
[2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate (PubChem CID 55320891) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55320891 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)OCC(=O)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H22N2O6S/c1-11-7-8-13(26(18,23)24)9-14(11)17(22)25-10-15(20)19-16(21)12-5-3-2-4-6-12/h7-9,12H,2-6,10H2,1H3,(H2,18,23,24)(H,19,20,21) |
| InChIKey | GDHLHKFNKBEHMD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |