C18H23NO6S — CID 55311991
[2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 55311991) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55311991 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCC(=O)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H23NO6S/c1-12-8-9-14(26(2,23)24)10-15(12)18(22)25-11-16(20)19-17(21)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,19,20,21) |
| InChIKey | JEEVDWPBJVISIM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |