C17H23NO5S — CID 7849759
[2-(azepan-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849759) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-(azepan-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849759 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | [2-(azepan-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCC(=O)N1CCCCCC1 |
| InChI | InChI=1S/C17H23NO5S/c1-13-7-8-14(24(2,21)22)11-15(13)17(20)23-12-16(19)18-9-5-3-4-6-10-18/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | PREMJVJUSMUPNA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |