C14H17NO5S — CID 7725460
(2-oxo-2-pyrrolidin-1-ylethyl) 2-methylsulfonylbenzoate (PubChem CID 7725460) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-methylsulfonylbenzoate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7725460 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H17NO5S/c1-21(18,19)12-7-3-2-6-11(12)14(17)20-10-13(16)15-8-4-5-9-15/h2-3,6-7H,4-5,8-10H2,1H3 |
| InChIKey | ZLLNWUZHPZRPEY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |