C17H22N2O6S — CID 7849377
[2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849377) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849377 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-(4-acetylpiperazin-1-yl)-2-oxoethyl] 2-methyl-5-methylsulfonylbenzoate |
| SMILES | CC(=O)N1CCN(C(=O)COC(=O)c2cc(S(C)(=O)=O)ccc2C)CC1 |
| InChI | InChI=1S/C17H22N2O6S/c1-12-4-5-14(26(3,23)24)10-15(12)17(22)25-11-16(21)19-8-6-18(7-9-19)13(2)20/h4-5,10H,6-9,11H2,1-3H3 |
| InChIKey | ISUSWRHLTSWZMY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |