C11H11NO4S — CID 7849718
cyanomethyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849718) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is cyanomethyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | cyanomethyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849718 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | cyanomethyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCC#N |
| InChI | InChI=1S/C11H11NO4S/c1-8-3-4-9(17(2,14)15)7-10(8)11(13)16-6-5-12/h3-4,7H,6H2,1-2H3 |
| InChIKey | ICZOEVMGIIYYPX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |