C13H13NO4S2 — CID 47073636
1,3-thiazol-2-ylmethyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 47073636) has the molecular formula C13H13NO4S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 1,3-thiazol-2-ylmethyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | 1,3-thiazol-2-ylmethyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 47073636 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 1,3-thiazol-2-ylmethyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCc1nccs1 |
| InChI | InChI=1S/C13H13NO4S2/c1-9-3-4-10(20(2,16)17)7-11(9)13(15)18-8-12-14-5-6-19-12/h3-7H,8H2,1-2H3 |
| InChIKey | ISRRJIJDENAWBL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |