C17H16Cl2O5S — CID 7849697
2-(2,6-dichlorophenoxy)ethyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849697) has the molecular formula C17H16Cl2O5S and a molecular weight of 403.28 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7849697 |
| Molecular Formula | C17H16Cl2O5S |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCCOc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H16Cl2O5S/c1-11-6-7-12(25(2,21)22)10-13(11)17(20)24-9-8-23-16-14(18)4-3-5-15(16)19/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | BHAVZKZUDWHALV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|