C16H13Cl3O5S — CID 2502520
2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-methylsulfonylbenzoate (PubChem CID 2502520) has the molecular formula C16H13Cl3O5S and a molecular weight of 423.70 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2502520 |
| Molecular Formula | C16H13Cl3O5S |
| Molecular Weight | 423.70 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)ethyl 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl3O5S/c1-25(21,22)11-3-4-13(18)12(9-11)16(20)24-7-6-23-15-5-2-10(17)8-14(15)19/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | AHTNARXCTNAXQK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|