C17H17Cl2NO5S — CID 39412489
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2,5-dichlorobenzoate (PubChem CID 39412489) has the molecular formula C17H17Cl2NO5S and a molecular weight of 418.30 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2,5-dichlorobenzoate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 39412489 |
| Molecular Formula | C17H17Cl2NO5S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 2,5-dichlorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOC(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO5S/c1-20(2)26(22,23)14-6-4-13(5-7-14)24-9-10-25-17(21)15-11-12(18)3-8-16(15)19/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | TYAATYIKTTVDHM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|