About 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate (PubChem CID 33077530) has the molecular formula C17H17BrFNO5S
and a molecular weight of 446.29 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate |
| PubChem CID | 33077530 |
| Molecular Formula | C17H17BrFNO5S |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOC(=O)c2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C17H17BrFNO5S/c1-20(2)26(22,23)14-6-4-13(5-7-14)24-9-10-25-17(21)15-8-3-12(18)11-16(15)19/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | KGONIYCPSRGSTK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate?
The IUPAC name of 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate (CID 33077530) is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate.
What is the SMILES notation for 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate?
The canonical SMILES for 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate is CN(C)S(=O)(=O)c1ccc(OCCOC(=O)c2ccc(Br)cc2F)cc1.
What is the InChIKey of 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate?
The InChIKey is KGONIYCPSRGSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrFNO5S/c1-20(2)26(22,23)14-6-4-13(5-7-14)24-9-10-25-17(21)15-8-3-12(18)11-16(15)19/h3-8,11H,9-10H2,1-2H3.
What are the key properties of 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate?
2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate has a molecular weight of 446.29 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylsulfamoyl)phenoxy]ethyl 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 33077530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).