C16H17BrFNO4S — CID 39601918
4-[2-(2-bromo-4-fluorophenoxy)ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 39601918) has the molecular formula C16H17BrFNO4S and a molecular weight of 418.28 g/mol. Its IUPAC name is 4-[2-(2-bromo-4-fluorophenoxy)ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(2-bromo-4-fluorophenoxy)ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 39601918 |
| Molecular Formula | C16H17BrFNO4S |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 4-[2-(2-bromo-4-fluorophenoxy)ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C16H17BrFNO4S/c1-19(2)24(20,21)14-6-4-13(5-7-14)22-9-10-23-16-8-3-12(18)11-15(16)17/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | GSLAHJGRRLQHPO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|