C20H24F2N2O5S — CID 97254165
2-[4-(dimethylsulfamoyl)phenoxy]ethyl (2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)acetate (PubChem CID 97254165) has the molecular formula C20H24F2N2O5S and a molecular weight of 442.48 g/mol. Its IUPAC name is 2-[4-(dimethylsulfamoyl)phenoxy]ethyl (2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)acetate.
| Compound Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl (2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 97254165 |
| Molecular Formula | C20H24F2N2O5S |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 2-[4-(dimethylsulfamoyl)phenoxy]ethyl (2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)acetate |
| SMILES | CN(C)[C@H](C(=O)OCCOc1ccc(S(=O)(=O)N(C)C)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H24F2N2O5S/c1-23(2)19(18-16(21)6-5-7-17(18)22)20(25)29-13-12-28-14-8-10-15(11-9-14)30(26,27)24(3)4/h5-11,19H,12-13H2,1-4H3/t19-/m0/s1 |
| InChIKey | YCZYVIYQTAMXAW-IBGZPJMESA-N |
| XLogP | 2.44 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|