C15H12ClF2NO5S — CID 9229725
2-(4-sulfamoylphenoxy)ethyl 2-chloro-4,5-difluorobenzoate (PubChem CID 9229725) has the molecular formula C15H12ClF2NO5S and a molecular weight of 391.78 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl 2-chloro-4,5-difluorobenzoate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 9229725 |
| Molecular Formula | C15H12ClF2NO5S |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl 2-chloro-4,5-difluorobenzoate |
| SMILES | NS(=O)(=O)c1ccc(OCCOC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C15H12ClF2NO5S/c16-12-8-14(18)13(17)7-11(12)15(20)24-6-5-23-9-1-3-10(4-2-9)25(19,21)22/h1-4,7-8H,5-6H2,(H2,19,21,22) |
| InChIKey | RGVOHQNRKQFXDN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|