C19H22ClNO5S — CID 40741883
2-(4-sulfamoylphenoxy)ethyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 40741883) has the molecular formula C19H22ClNO5S and a molecular weight of 411.91 g/mol. Its IUPAC name is 2-(4-sulfamoylphenoxy)ethyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | 2-(4-sulfamoylphenoxy)ethyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 40741883 |
| Molecular Formula | C19H22ClNO5S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 2-(4-sulfamoylphenoxy)ethyl (2R)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCCOc1ccc(S(N)(=O)=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClNO5S/c1-13(2)18(14-3-5-15(20)6-4-14)19(22)26-12-11-25-16-7-9-17(10-8-16)27(21,23)24/h3-10,13,18H,11-12H2,1-2H3,(H2,21,23,24)/t18-/m1/s1 |
| InChIKey | FUAPUBIREWVTTO-GOSISDBHSA-N |
| XLogP | 3.35 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|