C11H12ClLiO2 — CID 139900387
lithium 2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 139900387) has the molecular formula C11H12ClLiO2 and a molecular weight of 218.61 g/mol. Its IUPAC name is lithium 2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | lithium 2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 139900387 |
| Molecular Formula | C11H12ClLiO2 |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | lithium 2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | CC(C)C(C(=O)[O-])c1ccc(Cl)cc1.[Li+] |
| InChI | InChI=1S/C11H13ClO2.Li/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8;/h3-7,10H,1-2H3,(H,13,14);/q;+1/p-1 |
| InChIKey | HECYFNHKXBPYGY-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |