C11H13ClOS — CID 12774585
2-(4-chlorophenyl)-3-methylbutanethioic S-acid (PubChem CID 12774585) has the molecular formula C11H13ClOS and a molecular weight of 228.74 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-methylbutanethioic S-acid.
| Compound Name | 2-(4-chlorophenyl)-3-methylbutanethioic S-acid |
|---|---|
| PubChem CID | 12774585 |
| Molecular Formula | C11H13ClOS |
| Molecular Weight | 228.74 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-(4-chlorophenyl)-3-methylbutanethioic S-acid |
| SMILES | CC(C)C(C(=O)S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClOS/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8/h3-7,10H,1-2H3,(H,13,14) |
| InChIKey | AJYIDBJRCLVDAP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.74 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|