About azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid
azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid (PubChem CID 70402898) has the molecular formula C11H16ClNO2
and a molecular weight of 229.71 g/mol. Its IUPAC name is azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid.
Molecular Properties
| Compound Name | azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid |
| PubChem CID | 70402898 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)c1ccc(Cl)cc1.N |
| InChI | InChI=1S/C11H13ClO2.H3N/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8;/h3-7,10H,1-2H3,(H,13,14);1H3/t10-;/m1./s1 |
| InChIKey | NEVLNCWTZCAVSX-HNCPQSOCSA-N |
| XLogP | 3.33 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid?
The IUPAC name of azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid (CID 70402898) is azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid.
What is the SMILES notation for azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid?
The canonical SMILES for azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid is CC(C)[C@@H](C(=O)O)c1ccc(Cl)cc1.N.
What is the InChIKey of azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid?
The InChIKey is NEVLNCWTZCAVSX-HNCPQSOCSA-N. The full InChI is InChI=1S/C11H13ClO2.H3N/c1-7(2)10(11(13)14)8-3-5-9(12)6-4-8;/h3-7,10H,1-2H3,(H,13,14);1H3/t10-;/m1./s1.
What are the key properties of azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid?
azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid has a molecular weight of 229.71 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2R)-2-(4-chlorophenyl)-3-methylbutanoic acid is sourced from PubChem (CID 70402898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).