C11H12ClIO2 — CID 175517588
2-(4-chlorophenyl)-4-iodo-3-methylbutanoic acid (PubChem CID 175517588) has the molecular formula C11H12ClIO2 and a molecular weight of 338.57 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-iodo-3-methylbutanoic acid.
| Compound Name | 2-(4-chlorophenyl)-4-iodo-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175517588 |
| Molecular Formula | C11H12ClIO2 |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 2-(4-chlorophenyl)-4-iodo-3-methylbutanoic acid |
| SMILES | CC(CI)C(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClIO2/c1-7(6-13)10(11(14)15)8-2-4-9(12)5-3-8/h2-5,7,10H,6H2,1H3,(H,14,15) |
| InChIKey | RRKPOKDNTFUQMX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|