C13H14ClF3O2 — CID 57022881
2-(4-chlorophenyl)-3-(trifluoromethyl)hexanoic acid (PubChem CID 57022881) has the molecular formula C13H14ClF3O2 and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(trifluoromethyl)hexanoic acid.
| Compound Name | 2-(4-chlorophenyl)-3-(trifluoromethyl)hexanoic acid |
|---|---|
| PubChem CID | 57022881 |
| Molecular Formula | C13H14ClF3O2 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(trifluoromethyl)hexanoic acid |
| SMILES | CCCC(C(C(=O)O)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H14ClF3O2/c1-2-3-10(13(15,16)17)11(12(18)19)8-4-6-9(14)7-5-8/h4-7,10-11H,2-3H2,1H3,(H,18,19) |
| InChIKey | BALSIUDBNCFEQY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |