C13H15F3O2 — CID 89455084
(2S,3R)-2-(4-ethylphenyl)-4,4,4-trifluoro-3-methylbutanoic acid (PubChem CID 89455084) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is (2S,3R)-2-(4-ethylphenyl)-4,4,4-trifluoro-3-methylbutanoic acid.
| Compound Name | (2S,3R)-2-(4-ethylphenyl)-4,4,4-trifluoro-3-methylbutanoic acid |
|---|---|
| PubChem CID | 89455084 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (2S,3R)-2-(4-ethylphenyl)-4,4,4-trifluoro-3-methylbutanoic acid |
| SMILES | CCc1ccc([C@@H](C(=O)O)[C@@H](C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O2/c1-3-9-4-6-10(7-5-9)11(12(17)18)8(2)13(14,15)16/h4-8,11H,3H2,1-2H3,(H,17,18)/t8-,11+/m1/s1 |
| InChIKey | AIBRKLKFVILMHT-KCJUWKMLSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |