C13H15F3O2 — CID 58136361
5,5,5-trifluoro-3-methyl-2-(4-methylphenyl)pentanoic acid (PubChem CID 58136361) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5,5,5-trifluoro-3-methyl-2-(4-methylphenyl)pentanoic acid.
| Compound Name | 5,5,5-trifluoro-3-methyl-2-(4-methylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 58136361 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5,5,5-trifluoro-3-methyl-2-(4-methylphenyl)pentanoic acid |
| SMILES | Cc1ccc(C(C(=O)O)C(C)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O2/c1-8-3-5-10(6-4-8)11(12(17)18)9(2)7-13(14,15)16/h3-6,9,11H,7H2,1-2H3,(H,17,18) |
| InChIKey | WDOGHTTZQDFARW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |