About 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid
1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid (PubChem CID 143857654) has the molecular formula C20H26O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid |
| PubChem CID | 143857654 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid |
| SMILES | CC(C)c1ccc(C(=O)O)cc1.Cc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C10H12O2.C10H14/c1-7(2)8-3-5-9(6-4-8)10(11)12;1-8(2)10-6-4-9(3)5-7-10/h3-7H,1-2H3,(H,11,12);4-8H,1-3H3 |
| InChIKey | XQICOEQNOBJGEM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid?
The IUPAC name of 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid (CID 143857654) is 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid.
What is the SMILES notation for 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid?
The canonical SMILES for 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid is CC(C)c1ccc(C(=O)O)cc1.Cc1ccc(C(C)C)cc1.
What is the InChIKey of 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid?
The InChIKey is XQICOEQNOBJGEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C10H14/c1-7(2)8-3-5-9(6-4-8)10(11)12;1-8(2)10-6-4-9(3)5-7-10/h3-7H,1-2H3,(H,11,12);4-8H,1-3H3.
What are the key properties of 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid?
1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid has a molecular weight of 298.43 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylbenzene;4-propan-2-ylbenzoic acid is sourced from PubChem (CID 143857654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).