About 4-methylbenzoic acid;molecular nitrogen;hydrochloride
4-methylbenzoic acid;molecular nitrogen;hydrochloride (PubChem CID 174650579) has the molecular formula C8H9ClN2O2
and a molecular weight of 200.63 g/mol. Its IUPAC name is 4-methylbenzoic acid;molecular nitrogen;hydrochloride.
Molecular Properties
| Compound Name | 4-methylbenzoic acid;molecular nitrogen;hydrochloride |
| PubChem CID | 174650579 |
| Molecular Formula | C8H9ClN2O2 |
| Molecular Weight | 200.63 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 4-methylbenzoic acid;molecular nitrogen;hydrochloride |
| SMILES | Cc1ccc(C(=O)O)cc1.Cl.N#N |
| InChI | InChI=1S/C8H8O2.ClH.N2/c1-6-2-4-7(5-3-6)8(9)10;;1-2/h2-5H,1H3,(H,9,10);1H; |
| InChIKey | VPAOIWKYQAFNSH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzoic acid;molecular nitrogen;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzoic acid;molecular nitrogen;hydrochloride?
The IUPAC name of 4-methylbenzoic acid;molecular nitrogen;hydrochloride (CID 174650579) is 4-methylbenzoic acid;molecular nitrogen;hydrochloride.
What is the SMILES notation for 4-methylbenzoic acid;molecular nitrogen;hydrochloride?
The canonical SMILES for 4-methylbenzoic acid;molecular nitrogen;hydrochloride is Cc1ccc(C(=O)O)cc1.Cl.N#N.
What is the InChIKey of 4-methylbenzoic acid;molecular nitrogen;hydrochloride?
The InChIKey is VPAOIWKYQAFNSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.ClH.N2/c1-6-2-4-7(5-3-6)8(9)10;;1-2/h2-5H,1H3,(H,9,10);1H;.
What are the key properties of 4-methylbenzoic acid;molecular nitrogen;hydrochloride?
4-methylbenzoic acid;molecular nitrogen;hydrochloride has a molecular weight of 200.63 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzoic acid;molecular nitrogen;hydrochloride is sourced from PubChem (CID 174650579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).