About acetonitrile;4-methylbenzoic acid
acetonitrile;4-methylbenzoic acid (PubChem CID 174694292) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is acetonitrile;4-methylbenzoic acid.
Molecular Properties
| Compound Name | acetonitrile;4-methylbenzoic acid |
| PubChem CID | 174694292 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | acetonitrile;4-methylbenzoic acid |
| SMILES | CC#N.Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H8O2.C2H3N/c1-6-2-4-7(5-3-6)8(9)10;1-2-3/h2-5H,1H3,(H,9,10);1H3 |
| InChIKey | ZEVZJYWWGRYGFB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;4-methylbenzoic acid?
The IUPAC name of acetonitrile;4-methylbenzoic acid (CID 174694292) is acetonitrile;4-methylbenzoic acid.
What is the SMILES notation for acetonitrile;4-methylbenzoic acid?
The canonical SMILES for acetonitrile;4-methylbenzoic acid is CC#N.Cc1ccc(C(=O)O)cc1.
What is the InChIKey of acetonitrile;4-methylbenzoic acid?
The InChIKey is ZEVZJYWWGRYGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C2H3N/c1-6-2-4-7(5-3-6)8(9)10;1-2-3/h2-5H,1H3,(H,9,10);1H3.
What are the key properties of acetonitrile;4-methylbenzoic acid?
acetonitrile;4-methylbenzoic acid has a molecular weight of 177.20 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;4-methylbenzoic acid is sourced from PubChem (CID 174694292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).