C14H16ClF3O — CID 58288347
(2S,3R)-4,4,4-trifluoro-3-methyl-2-(4-propan-2-ylphenyl)butanoyl chloride (PubChem CID 58288347) has the molecular formula C14H16ClF3O and a molecular weight of 292.73 g/mol. Its IUPAC name is (2S,3R)-4,4,4-trifluoro-3-methyl-2-(4-propan-2-ylphenyl)butanoyl chloride.
| Compound Name | (2S,3R)-4,4,4-trifluoro-3-methyl-2-(4-propan-2-ylphenyl)butanoyl chloride |
|---|---|
| PubChem CID | 58288347 |
| Molecular Formula | C14H16ClF3O |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (2S,3R)-4,4,4-trifluoro-3-methyl-2-(4-propan-2-ylphenyl)butanoyl chloride |
| SMILES | CC(C)c1ccc([C@@H](C(=O)Cl)[C@@H](C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H16ClF3O/c1-8(2)10-4-6-11(7-5-10)12(13(15)19)9(3)14(16,17)18/h4-9,12H,1-3H3/t9-,12+/m1/s1 |
| InChIKey | OJUDSDINVFKIAH-SKDRFNHKSA-N |
| XLogP | 4.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|