C11H10F4O2 — CID 146050157
4,4,4-trifluoro-2-(3-fluorophenyl)-3-methylbutanoic acid (PubChem CID 146050157) has the molecular formula C11H10F4O2 and a molecular weight of 250.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-(3-fluorophenyl)-3-methylbutanoic acid.
| Compound Name | 4,4,4-trifluoro-2-(3-fluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 146050157 |
| Molecular Formula | C11H10F4O2 |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4,4,4-trifluoro-2-(3-fluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C(C(=O)O)c1cccc(F)c1)C(F)(F)F |
| InChI | InChI=1S/C11H10F4O2/c1-6(11(13,14)15)9(10(16)17)7-3-2-4-8(12)5-7/h2-6,9H,1H3,(H,16,17) |
| InChIKey | IRNVORQIGAVQBD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |