About CID 87816852
CID 87816852 (PubChem CID 87816852) has the molecular formula C8H6AsFO2
and a molecular weight of 228.05 g/mol.
Molecular Properties
| Compound Name | CID 87816852 |
| PubChem CID | 87816852 |
| Molecular Formula | C8H6AsFO2 |
| Molecular Weight | 228.05 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | — |
| SMILES | O=C(O)C([As])c1cccc(F)c1 |
| InChI | InChI=1S/C8H6AsFO2/c9-7(8(11)12)5-2-1-3-6(10)4-5/h1-4,7H,(H,11,12) |
| InChIKey | ROKRUMMTSDDKLP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.05 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87816852 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87816852?
The IUPAC name of CID 87816852 (CID 87816852) is not available.
What is the SMILES notation for CID 87816852?
The canonical SMILES for CID 87816852 is O=C(O)C([As])c1cccc(F)c1.
What is the InChIKey of CID 87816852?
The InChIKey is ROKRUMMTSDDKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6AsFO2/c9-7(8(11)12)5-2-1-3-6(10)4-5/h1-4,7H,(H,11,12).
What are the key properties of CID 87816852?
CID 87816852 has a molecular weight of 228.05 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87816852 is sourced from PubChem (CID 87816852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).