C16H13F2NO2 — CID 59093514
4,4-bis(3-fluorophenyl)-2-oxobutanamide (PubChem CID 59093514) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4,4-bis(3-fluorophenyl)-2-oxobutanamide.
| Compound Name | 4,4-bis(3-fluorophenyl)-2-oxobutanamide |
|---|---|
| PubChem CID | 59093514 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4,4-bis(3-fluorophenyl)-2-oxobutanamide |
| SMILES | NC(=O)C(=O)CC(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H13F2NO2/c17-12-5-1-3-10(7-12)14(9-15(20)16(19)21)11-4-2-6-13(18)8-11/h1-8,14H,9H2,(H2,19,21) |
| InChIKey | MFXGTRXRVSRDIO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|