C11H17F2NO2 — CID 143238171
2-aminopropanoic acid;1,3-difluorobenzene;ethane (PubChem CID 143238171) has the molecular formula C11H17F2NO2 and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-aminopropanoic acid;1,3-difluorobenzene;ethane.
| Compound Name | 2-aminopropanoic acid;1,3-difluorobenzene;ethane |
|---|---|
| PubChem CID | 143238171 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-aminopropanoic acid;1,3-difluorobenzene;ethane |
| SMILES | CC.CC(N)C(=O)O.Fc1cccc(F)c1 |
| InChI | InChI=1S/C6H4F2.C3H7NO2.C2H6/c7-5-2-1-3-6(8)4-5;1-2(4)3(5)6;1-2/h1-4H;2H,4H2,1H3,(H,5,6);1-2H3 |
| InChIKey | CBMNHCROVWUUAM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |