C10H13FN2O — CID 43123316
2-amino-N-[(3-fluorophenyl)methyl]propanamide (PubChem CID 43123316) has the molecular formula C10H13FN2O and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-amino-N-[(3-fluorophenyl)methyl]propanamide.
| Compound Name | 2-amino-N-[(3-fluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 43123316 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-amino-N-[(3-fluorophenyl)methyl]propanamide |
| SMILES | CC(N)C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C10H13FN2O/c1-7(12)10(14)13-6-8-3-2-4-9(11)5-8/h2-5,7H,6,12H2,1H3,(H,13,14) |
| InChIKey | CWEMWGFQSOSEFP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |