C20H26FN3O — CID 67841783
2-amino-N-[[4-[4-(3-fluorophenyl)butylamino]phenyl]methyl]propanamide (PubChem CID 67841783) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-amino-N-[[4-[4-(3-fluorophenyl)butylamino]phenyl]methyl]propanamide.
| Compound Name | 2-amino-N-[[4-[4-(3-fluorophenyl)butylamino]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 67841783 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-amino-N-[[4-[4-(3-fluorophenyl)butylamino]phenyl]methyl]propanamide |
| SMILES | CC(N)C(=O)NCc1ccc(NCCCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H26FN3O/c1-15(22)20(25)24-14-17-8-10-19(11-9-17)23-12-3-2-5-16-6-4-7-18(21)13-16/h4,6-11,13,15,23H,2-3,5,12,14,22H2,1H3,(H,24,25) |
| InChIKey | KKXCYAAELKMEGR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|